C10H12F3IN4 — CID 164719045
(Z)-2-[(3-iodo-1-methylpyrazol-4-yl)methyl]-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine (PubChem CID 164719045) has the molecular formula C10H12F3IN4 and a molecular weight of 372.13 g/mol. Its IUPAC name is (Z)-2-[(3-iodo-1-methylpyrazol-4-yl)methyl]-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine.
| Compound Name | (Z)-2-[(3-iodo-1-methylpyrazol-4-yl)methyl]-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine |
|---|---|
| PubChem CID | 164719045 |
| Molecular Formula | C10H12F3IN4 |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | (Z)-2-[(3-iodo-1-methylpyrazol-4-yl)methyl]-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine |
| SMILES | Cn1cc(CC(=C/N)/C=N/CC(F)(F)F)c(I)n1 |
| InChI | InChI=1S/C10H12F3IN4/c1-18-5-8(9(14)17-18)2-7(3-15)4-16-6-10(11,12)13/h3-5H,2,6,15H2,1H3/b7-3-,16-4+ |
| InChIKey | XSMYQXLZWHNBME-MNICVSAOSA-N |
| XLogP | 2.04 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|