C18H18FIN4O — CID 164719046
[1-(cyclopropylmethyl)pyrazol-4-yl]-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol (PubChem CID 164719046) has the molecular formula C18H18FIN4O and a molecular weight of 452.27 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)pyrazol-4-yl]-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol.
| Compound Name | [1-(cyclopropylmethyl)pyrazol-4-yl]-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 164719046 |
| Molecular Formula | C18H18FIN4O |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | [1-(cyclopropylmethyl)pyrazol-4-yl]-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol |
| SMILES | Cc1cc(C(O)c2cnn(CC3CC3)c2)n(-c2ccc(F)cc2I)n1 |
| InChI | InChI=1S/C18H18FIN4O/c1-11-6-17(24(22-11)16-5-4-14(19)7-15(16)20)18(25)13-8-21-23(10-13)9-12-2-3-12/h4-8,10,12,18,25H,2-3,9H2,1H3 |
| InChIKey | AICFVVKQESPKLD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|