C36H32FN5O5S — CID 164721242
3-[6-[2-[2-[[4-[4-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione (PubChem CID 164721242) has the molecular formula C36H32FN5O5S and a molecular weight of 665.75 g/mol. Its IUPAC name is 3-[6-[2-[2-[[4-[4-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[6-[2-[2-[[4-[4-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 164721242 |
| Molecular Formula | C36H32FN5O5S |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | 3-[6-[2-[2-[[4-[4-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(N2Cc3cc(OCCOCCNc4cc(-c5ccc(-c6nc7ccc(F)cc7s6)cc5)ccn4)ccc3C2=O)C1=O |
| InChI | InChI=1S/C36H32FN5O5S/c1-41-33(43)11-10-30(36(41)45)42-21-25-18-27(7-8-28(25)35(42)44)47-17-16-46-15-14-39-32-19-24(12-13-38-32)22-2-4-23(5-3-22)34-40-29-9-6-26(37)20-31(29)48-34/h2-9,12-13,18-20,30H,10-11,14-17,21H2,1H3,(H,38,39) |
| InChIKey | WYEZXKAJTRENRH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|