C35H30N6O5 — CID 164721284
4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-[5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-pyridinyl]butanamide (PubChem CID 164721284) has the molecular formula C35H30N6O5 and a molecular weight of 614.66 g/mol. Its IUPAC name is 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-[5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-pyridinyl]butanamide.
| Compound Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-[5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-pyridinyl]butanamide |
|---|---|
| PubChem CID | 164721284 |
| Molecular Formula | C35H30N6O5 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-[5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-pyridinyl]butanamide |
| SMILES | O=C1CCC(N2Cc3cc(OCCCC(=O)Nc4ccc(-c5ccc(-c6cc7ccncc7[nH]6)cc5)cn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H30N6O5/c42-32(2-1-15-46-26-8-9-27-25(16-26)20-41(35(27)45)30-10-12-33(43)40-34(30)44)39-31-11-7-24(18-37-31)21-3-5-22(6-4-21)28-17-23-13-14-36-19-29(23)38-28/h3-9,11,13-14,16-19,30,38H,1-2,10,12,15,20H2,(H,37,39,42)(H,40,43,44) |
| InChIKey | SPDBFIURVFJJRW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|