C50H69Cl2FN4O5 — CID 164721965
CID 164721965 (PubChem CID 164721965) has the molecular formula C50H69Cl2FN4O5 and a molecular weight of 896.03 g/mol.
| Compound Name | CID 164721965 |
|---|---|
| PubChem CID | 164721965 |
| Molecular Formula | C50H69Cl2FN4O5 |
| Molecular Weight | 896.03 g/mol |
| Exact Mass | 894.46 |
| IUPAC Name | — |
| SMILES | COC(=O)C1(C)CC[C@@H](NC(=O)[C@@H]2NC3(CCC(C4CC(C)CCC4C(C)C)(C4CC(C)CCC4C(C)C)CC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2ccnc(Cl)c2F)CO1 |
| InChI | InChI=1S/C50H69Cl2FN4O5/c1-27(2)33-12-9-29(5)23-37(33)48(38-24-30(6)10-13-34(38)28(3)4)18-20-49(21-19-48)50(36-14-11-31(51)25-39(36)56-45(50)59)40(35-16-22-54-43(52)41(35)53)42(57-49)44(58)55-32-15-17-47(7,62-26-32)46(60)61-8/h11,14,16,22,25,27-30,32-34,37-38,40,42,57H,9-10,12-13,15,17-21,23-24,26H2,1-8H3,(H,55,58)(H,56,59)/t29?,30?,32-,33?,34?,37?,38?,40+,42-,47?,48?,49?,50-/m1/s1 |
| InChIKey | XLHWUBKDRSTEQZ-GHEJNUPYSA-N |
| XLogP | 10.42 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.03 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|