C45H27N3O2 — CID 164723679
2-(10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 164723679) has the molecular formula C45H27N3O2 and a molecular weight of 641.73 g/mol. Its IUPAC name is 2-(10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 164723679 |
| Molecular Formula | C45H27N3O2 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | 2-(10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4cccc5c4oc4cc6c(cc45)oc4ccccc46)n3)c2)cc1 |
| InChI | InChI=1S/C45H27N3O2/c1-3-12-28(13-4-1)30-16-9-18-32(24-30)43-46-44(33-19-10-17-31(25-33)29-14-5-2-6-15-29)48-45(47-43)36-22-11-21-35-38-27-40-37(26-41(38)50-42(35)36)34-20-7-8-23-39(34)49-40/h1-27H |
| InChIKey | NTQPQSIXJSTXQL-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |