C58H37N5 — CID 164723929
7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-10,14-diphenyl-10,15-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene (PubChem CID 164723929) has the molecular formula C58H37N5 and a molecular weight of 803.97 g/mol. Its IUPAC name is 7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-10,14-diphenyl-10,15-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene.
| Compound Name | 7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-10,14-diphenyl-10,15-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 164723929 |
| Molecular Formula | C58H37N5 |
| Molecular Weight | 803.97 g/mol |
| Exact Mass | 803.30 |
| IUPAC Name | 7-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-10,14-diphenyl-10,15-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5ccc6c7cc8c(cc7n(-c7ccccc7)c6c5)c(-c5ccccc5)nc5ccccc58)c4)c3)n2)cc1 |
| InChI | InChI=1S/C58H37N5/c1-5-17-38(18-6-1)55-51-37-54-50(36-49(51)47-29-13-14-30-52(47)59-55)48-32-31-44(35-53(48)63(54)46-27-11-4-12-28-46)42-24-15-23-41(33-42)43-25-16-26-45(34-43)58-61-56(39-19-7-2-8-20-39)60-57(62-58)40-21-9-3-10-22-40/h1-37H |
| InChIKey | WKYKIXUNXIREFN-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.97 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|