C36H29F3N2O5 — CID 164725168
5-[2-[2,3-dimethyl-4-[2,2,2-trifluoro-1-(2,3,4-trimethylphenyl)ethyl]phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione (PubChem CID 164725168) has the molecular formula C36H29F3N2O5 and a molecular weight of 626.63 g/mol. Its IUPAC name is 5-[2-[2,3-dimethyl-4-[2,2,2-trifluoro-1-(2,3,4-trimethylphenyl)ethyl]phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2,3-dimethyl-4-[2,2,2-trifluoro-1-(2,3,4-trimethylphenyl)ethyl]phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 164725168 |
| Molecular Formula | C36H29F3N2O5 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 5-[2-[2,3-dimethyl-4-[2,2,2-trifluoro-1-(2,3,4-trimethylphenyl)ethyl]phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(C(c2ccc(N3C(=O)c4ccc(Oc5ccc6c(c5)C(=O)N(C)C6=O)cc4C3=O)c(C)c2C)C(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C36H29F3N2O5/c1-17-7-10-24(19(3)18(17)2)31(36(37,38)39)25-13-14-30(21(5)20(25)4)41-34(44)27-12-9-23(16-29(27)35(41)45)46-22-8-11-26-28(15-22)33(43)40(6)32(26)42/h7-16,31H,1-6H3 |
| InChIKey | TVXFICFBAMOBSL-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|