C20H26ClFN4O3S — CID 164725515
(2'S,4S,6'S,7S)-2-chloro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol (PubChem CID 164725515) has the molecular formula C20H26ClFN4O3S and a molecular weight of 456.97 g/mol. Its IUPAC name is (2'S,4S,6'S,7S)-2-chloro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol.
| Compound Name | (2'S,4S,6'S,7S)-2-chloro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 164725515 |
| Molecular Formula | C20H26ClFN4O3S |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (2'S,4S,6'S,7S)-2-chloro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(CC4(F)CCOCC4)nn3)N1)OC[C@@H](O)c1cc(Cl)sc12 |
| InChI | InChI=1S/C20H26ClFN4O3S/c1-12-7-20(18-13(6-17(21)30-18)16(27)10-29-20)8-14(23-12)15-9-26(25-24-15)11-19(22)2-4-28-5-3-19/h6,9,12,14,16,23,27H,2-5,7-8,10-11H2,1H3/t12-,14-,16+,20-/m0/s1 |
| InChIKey | WEYAMOBJPBWZHM-APDCYYIMSA-N |
| XLogP | 3.28 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |