C22H23ClF2N4O2S — CID 164725522
2-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-1-phenylethanol (PubChem CID 164725522) has the molecular formula C22H23ClF2N4O2S and a molecular weight of 480.97 g/mol. Its IUPAC name is 2-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-1-phenylethanol.
| Compound Name | 2-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 164725522 |
| Molecular Formula | C22H23ClF2N4O2S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-1-phenylethanol |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(CC(O)c4ccccc4)nn3)N1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C22H23ClF2N4O2S/c1-13-8-21(20-15(7-19(23)32-20)22(24,25)12-31-21)9-16(26-13)17-10-29(28-27-17)11-18(30)14-5-3-2-4-6-14/h2-7,10,13,16,18,26,30H,8-9,11-12H2,1H3/t13-,16-,18?,21-/m0/s1 |
| InChIKey | LRUAZKLMNCKGFJ-KTMVDNIASA-N |
| XLogP | 4.56 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |