C18H23ClF2N4O2S — CID 164725529
3-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylpropan-1-ol (PubChem CID 164725529) has the molecular formula C18H23ClF2N4O2S and a molecular weight of 432.92 g/mol. Its IUPAC name is 3-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylpropan-1-ol.
| Compound Name | 3-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 164725529 |
| Molecular Formula | C18H23ClF2N4O2S |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 3-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylpropan-1-ol |
| SMILES | CC(CO)Cn1cc([C@@H]2C[C@]3(C[C@H](C)N2)OCC(F)(F)c2cc(Cl)sc23)nn1 |
| InChI | InChI=1S/C18H23ClF2N4O2S/c1-10(8-26)6-25-7-14(23-24-25)13-5-17(4-11(2)22-13)16-12(3-15(19)28-16)18(20,21)9-27-17/h3,7,10-11,13,22,26H,4-6,8-9H2,1-2H3/t10?,11-,13-,17-/m0/s1 |
| InChIKey | ICRIGRAJFWYICZ-JEGLBNJZSA-N |
| XLogP | 3.45 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |