C18H23ClF2N4O3S2 — CID 164725590
(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(3-methylsulfonylpropyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725590) has the molecular formula C18H23ClF2N4O3S2 and a molecular weight of 480.99 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(3-methylsulfonylpropyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(3-methylsulfonylpropyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725590 |
| Molecular Formula | C18H23ClF2N4O3S2 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(3-methylsulfonylpropyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(CCCS(C)(=O)=O)nn3)N1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C18H23ClF2N4O3S2/c1-11-7-17(16-12(6-15(19)29-16)18(20,21)10-28-17)8-13(22-11)14-9-25(24-23-14)4-3-5-30(2,26)27/h6,9,11,13,22H,3-5,7-8,10H2,1-2H3/t11-,13-,17-/m0/s1 |
| InChIKey | QHXZLJJNOQBEFT-BNLOLNQZSA-N |
| XLogP | 3.26 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |