C19H19ClF2N6OS — CID 164725615
(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(pyrazin-2-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725615) has the molecular formula C19H19ClF2N6OS and a molecular weight of 452.92 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(pyrazin-2-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(pyrazin-2-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725615 |
| Molecular Formula | C19H19ClF2N6OS |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(pyrazin-2-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(Cc4cnccn4)nn3)N1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C19H19ClF2N6OS/c1-11-5-18(17-13(4-16(20)30-17)19(21,22)10-29-18)6-14(25-11)15-9-28(27-26-15)8-12-7-23-2-3-24-12/h2-4,7,9,11,14,25H,5-6,8,10H2,1H3/t11-,14-,18-/m0/s1 |
| InChIKey | XFVJMDSLKWAERD-MIUNTBIASA-N |
| XLogP | 3.66 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |