C15H21F2NOS — CID 164725625
(2'R,6'S)-2-(2,2-difluoroethyl)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725625) has the molecular formula C15H21F2NOS and a molecular weight of 301.40 g/mol. Its IUPAC name is (2'R,6'S)-2-(2,2-difluoroethyl)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'R,6'S)-2-(2,2-difluoroethyl)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725625 |
| Molecular Formula | C15H21F2NOS |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (2'R,6'S)-2-(2,2-difluoroethyl)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@@H]1CC2(C[C@H](C)N1)OCCc1cc(CC(F)F)sc12 |
| InChI | InChI=1S/C15H21F2NOS/c1-9-7-15(8-10(2)18-9)14-11(3-4-19-15)5-12(20-14)6-13(16)17/h5,9-10,13,18H,3-4,6-8H2,1-2H3/t9-,10+,15? |
| InChIKey | BXZNXTCBDSQMQY-WYPFBEBGSA-N |
| XLogP | 3.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |