C19H23ClF2N4O2S — CID 164725629
[1-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]cyclopropyl]methanol (PubChem CID 164725629) has the molecular formula C19H23ClF2N4O2S and a molecular weight of 444.94 g/mol. Its IUPAC name is [1-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]cyclopropyl]methanol.
| Compound Name | [1-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 164725629 |
| Molecular Formula | C19H23ClF2N4O2S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [1-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]cyclopropyl]methanol |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(CC4(CO)CC4)nn3)N1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C19H23ClF2N4O2S/c1-11-5-18(16-12(4-15(20)29-16)19(21,22)10-28-18)6-13(23-11)14-7-26(25-24-14)8-17(9-27)2-3-17/h4,7,11,13,23,27H,2-3,5-6,8-10H2,1H3/t11-,13-,18-/m0/s1 |
| InChIKey | BWOWFUUVKARTHS-FNFWKMNBSA-N |
| XLogP | 3.60 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |