C20H24ClF3N4O2S — CID 164725646
(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725646) has the molecular formula C20H24ClF3N4O2S and a molecular weight of 476.95 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725646 |
| Molecular Formula | C20H24ClF3N4O2S |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-[1-[(4-fluorooxan-4-yl)methyl]triazol-4-yl]-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(CC4(F)CCOCC4)nn3)N1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C20H24ClF3N4O2S/c1-12-7-19(17-13(6-16(21)31-17)20(23,24)11-30-19)8-14(25-12)15-9-28(27-26-15)10-18(22)2-4-29-5-3-18/h6,9,12,14,25H,2-5,7-8,10-11H2,1H3/t12-,14-,19-/m0/s1 |
| InChIKey | DTHGBUDSKRYDDY-PJFSTRORSA-N |
| XLogP | 4.34 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |