C17H16ClF5N4O2S — CID 164725662
1-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone (PubChem CID 164725662) has the molecular formula C17H16ClF5N4O2S and a molecular weight of 470.85 g/mol. Its IUPAC name is 1-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 164725662 |
| Molecular Formula | C17H16ClF5N4O2S |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(C)nn3)N1C(=O)C(F)(F)F)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C17H16ClF5N4O2S/c1-8-4-15(13-9(3-12(18)30-13)16(19,20)7-29-15)5-11(10-6-26(2)25-24-10)27(8)14(28)17(21,22)23/h3,6,8,11H,4-5,7H2,1-2H3/t8-,11-,15-/m0/s1 |
| InChIKey | FURHEKMACXGBQH-CYBUAMNDSA-N |
| XLogP | 4.16 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |