C20H22ClNO3S — CID 164725686
[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]methyl benzoate (PubChem CID 164725686) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is [(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]methyl benzoate.
| Compound Name | [(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]methyl benzoate |
|---|---|
| PubChem CID | 164725686 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]methyl benzoate |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](COC(=O)c3ccccc3)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C20H22ClNO3S/c1-13-10-20(18-15(7-8-25-20)9-17(21)26-18)11-16(22-13)12-24-19(23)14-5-3-2-4-6-14/h2-6,9,13,16,22H,7-8,10-12H2,1H3/t13-,16-,20-/m0/s1 |
| InChIKey | NWXDUHMDZLCXOE-RISOHXOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |