C17H21ClN2O3S — CID 164725706
(2'S,6'S,7S)-2-chloro-2'-[5-(methoxymethyl)-1,2-oxazol-3-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725706) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-2'-[5-(methoxymethyl)-1,2-oxazol-3-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-2'-[5-(methoxymethyl)-1,2-oxazol-3-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725706 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-2'-[5-(methoxymethyl)-1,2-oxazol-3-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | COCc1cc([C@@H]2C[C@]3(C[C@H](C)N2)OCCc2cc(Cl)sc23)no1 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-10-7-17(16-11(3-4-22-17)5-15(18)24-16)8-14(19-10)13-6-12(9-21-2)23-20-13/h5-6,10,14,19H,3-4,7-9H2,1-2H3/t10-,14-,17-/m0/s1 |
| InChIKey | GOKPNISYQCCBKN-NCHVAJSOSA-N |
| XLogP | 3.82 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |