C18H24ClNO3S — CID 164725739
ethyl 2-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]cyclopropane-1-carboxylate (PubChem CID 164725739) has the molecular formula C18H24ClNO3S and a molecular weight of 369.91 g/mol. Its IUPAC name is ethyl 2-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 164725739 |
| Molecular Formula | C18H24ClNO3S |
| Molecular Weight | 369.91 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl 2-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1[C@@H]1C[C@]2(C[C@H](C)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C18H24ClNO3S/c1-3-22-17(21)13-7-12(13)14-9-18(8-10(2)20-14)16-11(4-5-23-18)6-15(19)24-16/h6,10,12-14,20H,3-5,7-9H2,1-2H3/t10-,12?,13?,14-,18-/m0/s1 |
| InChIKey | GCCOUIGDIQFDMM-QQELZZIUSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |