C16H19ClN2O2S — CID 164725778
(2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methyl-1,2-oxazol-5-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725778) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methyl-1,2-oxazol-5-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methyl-1,2-oxazol-5-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725778 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methyl-1,2-oxazol-5-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | Cc1cc([C@@H]2C[C@]3(C[C@H](C)N2)OCCc2cc(Cl)sc23)on1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-9-5-13(21-19-9)12-8-16(7-10(2)18-12)15-11(3-4-20-16)6-14(17)22-15/h5-6,10,12,18H,3-4,7-8H2,1-2H3/t10-,12-,16-/m0/s1 |
| InChIKey | PGLKWRSAYJYKGU-PKWAYOAASA-N |
| XLogP | 3.98 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |