C18H21ClN2O2S — CID 164725821
(2'S,6'S,7S)-2-chloro-2'-(3-cyclopropyl-1,2-oxazol-5-yl)-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725821) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-2'-(3-cyclopropyl-1,2-oxazol-5-yl)-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-2'-(3-cyclopropyl-1,2-oxazol-5-yl)-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725821 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-2'-(3-cyclopropyl-1,2-oxazol-5-yl)-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cc(C4CC4)no3)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-10-8-18(17-12(4-5-22-18)6-16(19)24-17)9-14(20-10)15-7-13(21-23-15)11-2-3-11/h6-7,10-11,14,20H,2-5,8-9H2,1H3/t10-,14-,18-/m0/s1 |
| InChIKey | CJOKNPJJCVXIFO-KCJDHBRGSA-N |
| XLogP | 4.55 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |