C18H26N4OS — CID 164725826
(2'S,6'S)-2-ethyl-2',7-dimethyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 164725826) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is (2'S,6'S)-2-ethyl-2',7-dimethyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | (2'S,6'S)-2-ethyl-2',7-dimethyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 164725826 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (2'S,6'S)-2-ethyl-2',7-dimethyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | CCc1cc2c(s1)C(C)COC21C[C@@H](c2cn(C)nn2)N[C@@H](C)C1 |
| InChI | InChI=1S/C18H26N4OS/c1-5-13-6-14-17(24-13)11(2)10-23-18(14)7-12(3)19-15(8-18)16-9-22(4)21-20-16/h6,9,11-12,15,19H,5,7-8,10H2,1-4H3/t11?,12-,15-,18?/m0/s1 |
| InChIKey | SQXMQRYCINYXOI-XCQCNWSKSA-N |
| XLogP | 3.28 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |