C18H23ClN4OS — CID 164726164
5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylpyrimidin-2-amine (PubChem CID 164726164) has the molecular formula C18H23ClN4OS and a molecular weight of 378.93 g/mol. Its IUPAC name is 5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 164726164 |
| Molecular Formula | C18H23ClN4OS |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylpyrimidin-2-amine |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cnc(N(C)C)nc3)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C18H23ClN4OS/c1-11-7-18(16-12(4-5-24-18)6-15(19)25-16)8-14(22-11)13-9-20-17(21-10-13)23(2)3/h6,9-11,14,22H,4-5,7-8H2,1-3H3/t11-,14-,18-/m0/s1 |
| InChIKey | GPYJOAVVBZEKKY-MIUNTBIASA-N |
| XLogP | 3.54 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |