C65H54N4OSi — CID 164726868
[3-[6-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]carbazol-9-yl]-4-(trideuteriomethyl)-3-pyridinyl]phenyl]-triphenylsilane (PubChem CID 164726868) has the molecular formula C65H54N4OSi and a molecular weight of 938.28 g/mol. Its IUPAC name is [3-[6-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]carbazol-9-yl]-4-(trideuteriomethyl)-3-pyridinyl]phenyl]-triphenylsilane.
| Compound Name | [3-[6-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]carbazol-9-yl]-4-(trideuteriomethyl)-3-pyridinyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 164726868 |
| Molecular Formula | C65H54N4OSi |
| Molecular Weight | 938.28 g/mol |
| Exact Mass | 937.43 |
| IUPAC Name | [3-[6-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]carbazol-9-yl]-4-(trideuteriomethyl)-3-pyridinyl]phenyl]-triphenylsilane |
| SMILES | [2H]C([2H])([2H])c1cc(-n2c3ccccc3c3ccc(Oc4cccc(N5CN(c6cccc(C(C)(C)C)c6)c6ccccc65)c4)cc32)ncc1-c1cccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C65H54N4OSi/c1-46-39-64(66-44-59(46)47-21-18-32-56(40-47)71(53-26-8-5-9-27-53,54-28-10-6-11-29-54)55-30-12-7-13-31-55)69-60-34-15-14-33-57(60)58-38-37-52(43-63(58)69)70-51-25-20-24-50(42-51)68-45-67(61-35-16-17-36-62(61)68)49-23-19-22-48(41-49)65(2,3)4/h5-44H,45H2,1-4H3/i1D3 |
| InChIKey | LUSSTNDLXLGCMU-FIBGUPNXSA-N |
| XLogP | 13.87 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.28 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|