About bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten
bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten (PubChem CID 164728278) has the molecular formula C18H14N2O8W
and a molecular weight of 570.16 g/mol. Its IUPAC name is bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten.
Molecular Properties
| Compound Name | bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten |
| PubChem CID | 164728278 |
| Molecular Formula | C18H14N2O8W |
| Molecular Weight | 570.16 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten |
| SMILES | CN1C(=O)c2cc(O)c(O)cc2C1=O.CN1C(=O)c2cc(O)c(O)cc2C1=O.[W] |
| InChI | InChI=1S/2C9H7NO4.W/c2*1-10-8(13)4-2-6(11)7(12)3-5(4)9(10)14;/h2*2-3,11-12H,1H3; |
| InChIKey | QZKNMVTUQHSDND-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 570.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten?
The IUPAC name of bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten (CID 164728278) is bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten.
What is the SMILES notation for bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten?
The canonical SMILES for bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten is CN1C(=O)c2cc(O)c(O)cc2C1=O.CN1C(=O)c2cc(O)c(O)cc2C1=O.[W].
What is the InChIKey of bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten?
The InChIKey is QZKNMVTUQHSDND-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NO4.W/c2*1-10-8(13)4-2-6(11)7(12)3-5(4)9(10)14;/h2*2-3,11-12H,1H3;.
What are the key properties of bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten?
bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten has a molecular weight of 570.16 g/mol, XLogP of 0.64, 0 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5,6-dihydroxy-2-methylisoindole-1,3-dione);tungsten is sourced from PubChem (CID 164728278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).