C43H47F3IrNO3- — CID 164729441
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[5-(4,4-dimethylcyclohexyl)-1-benzofuran-2-yl]pyridine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-6-methylhept-3-en-2-one (PubChem CID 164729441) has the molecular formula C43H47F3IrNO3- and a molecular weight of 875.06 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[5-(4,4-dimethylcyclohexyl)-1-benzofuran-2-yl]pyridine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-6-methylhept-3-en-2-one.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[5-(4,4-dimethylcyclohexyl)-1-benzofuran-2-yl]pyridine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-6-methylhept-3-en-2-one |
|---|---|
| PubChem CID | 164729441 |
| Molecular Formula | C43H47F3IrNO3- |
| Molecular Weight | 875.06 g/mol |
| Exact Mass | 875.31 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-[5-(4,4-dimethylcyclohexyl)-1-benzofuran-2-yl]pyridine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-6-methylhept-3-en-2-one |
| SMILES | CC(C)C/C(O)=C/C(=O)C(F)(F)F.CC1(C)CCC(c2ccc3oc(-c4ccnc(-c5[c-]c6ccccc6c(C(C)(C)C)c5)c4)cc3c2)CC1.[Ir] |
| InChI | InChI=1S/C35H36NO.C8H11F3O2.Ir/c1-34(2,3)30-20-27(19-25-8-6-7-9-29(25)30)31-21-26(14-17-36-31)33-22-28-18-24(10-11-32(28)37-33)23-12-15-35(4,5)16-13-23;1-5(2)3-6(12)4-7(13)8(9,10)11;/h6-11,14,17-18,20-23H,12-13,15-16H2,1-5H3;4-5,12H,3H2,1-2H3;/q-1;;/b;6-4-; |
| InChIKey | SQKAMUGGIIVCLG-GONQOWGMSA-N |
| XLogP | 12.70 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.06 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|