About N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide
N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide (PubChem CID 164729663) has the molecular formula C7H11F3N2O3S
and a molecular weight of 260.24 g/mol. Its IUPAC name is N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide |
| PubChem CID | 164729663 |
| Molecular Formula | C7H11F3N2O3S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1CN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F3N2O3S/c1-16(14,15)11-2-5-3-12(4-5)6(13)7(8,9)10/h5,11H,2-4H2,1H3 |
| InChIKey | HMNHELBLOYZWKE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide (CID 164729663) is N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide is CS(=O)(=O)NCC1CN(C(=O)C(F)(F)F)C1.
What is the InChIKey of N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide?
The InChIKey is HMNHELBLOYZWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2O3S/c1-16(14,15)11-2-5-3-12(4-5)6(13)7(8,9)10/h5,11H,2-4H2,1H3.
What are the key properties of N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide?
N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide has a molecular weight of 260.24 g/mol, XLogP of -0.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]methanesulfonamide is sourced from PubChem (CID 164729663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).