C20H40 — CID 164732302
1,2,3,4-tetratert-butylcyclobutane (PubChem CID 164732302) has the molecular formula C20H40 and a molecular weight of 280.54 g/mol. Its IUPAC name is 1,2,3,4-tetratert-butylcyclobutane.
| Compound Name | 1,2,3,4-tetratert-butylcyclobutane |
|---|---|
| PubChem CID | 164732302 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | 1,2,3,4-tetratert-butylcyclobutane |
| SMILES | CC(C)(C)C1C(C(C)(C)C)C(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C20H40/c1-17(2,3)13-14(18(4,5)6)16(20(10,11)12)15(13)19(7,8)9/h13-16H,1-12H3 |
| InChIKey | MVSJHHKZYCFZEW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |