C18H24BN3O4S — CID 164732427
N-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2]thiazolo[5,4-b]pyridine-3-carboxamide (PubChem CID 164732427) has the molecular formula C18H24BN3O4S and a molecular weight of 389.29 g/mol. Its IUPAC name is N-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2]thiazolo[5,4-b]pyridine-3-carboxamide.
| Compound Name | N-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2]thiazolo[5,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164732427 |
| Molecular Formula | C18H24BN3O4S |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2]thiazolo[5,4-b]pyridine-3-carboxamide |
| SMILES | CC1(C)OB(c2cnc3snc(C(=O)NC4CCOCC4)c3c2)OC1(C)C |
| InChI | InChI=1S/C18H24BN3O4S/c1-17(2)18(3,4)26-19(25-17)11-9-13-14(22-27-16(13)20-10-11)15(23)21-12-5-7-24-8-6-12/h9-10,12H,5-8H2,1-4H3,(H,21,23) |
| InChIKey | ZVTCYBIWJDKUBC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|