C15H15N5O4 — CID 164732717
3-[4-(3-methoxyphenoxy)-1,3,5-triazin-2-yl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 164732717) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-[4-(3-methoxyphenoxy)-1,3,5-triazin-2-yl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-(3-methoxyphenoxy)-1,3,5-triazin-2-yl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164732717 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-[4-(3-methoxyphenoxy)-1,3,5-triazin-2-yl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1cccc(Oc2ncnc(N3C(=O)NC(C)(C)C3=O)n2)c1 |
| InChI | InChI=1S/C15H15N5O4/c1-15(2)11(21)20(14(22)19-15)12-16-8-17-13(18-12)24-10-6-4-5-9(7-10)23-3/h4-8H,1-3H3,(H,19,22) |
| InChIKey | FFTDOIHLOXNODK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|