C43H50BiIrN2O2- — CID 164733449
[6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-diphenylbismuthane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164733449) has the molecular formula C43H50BiIrN2O2- and a molecular weight of 1028.08 g/mol. Its IUPAC name is [6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-diphenylbismuthane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | [6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-diphenylbismuthane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164733449 |
| Molecular Formula | C43H50BiIrN2O2- |
| Molecular Weight | 1028.08 g/mol |
| Exact Mass | 1028.33 |
| IUPAC Name | [6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-diphenylbismuthane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2cc([Bi](c3ccccc3)c3ccccc3)ncn2)[c-]c2ccccc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C18H16N2.C13H24O2.2C6H5.Bi.Ir/c1-18(2,3)16-11-14(17-8-9-19-12-20-17)10-13-6-4-5-7-15(13)16;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;2*1-2-4-6-5-3-1;;/h4-8,11-12H,1-3H3;9-11,14H,5-8H2,1-4H3;2*1-5H;;/q-1;;;;;/b;12-9-;;;; |
| InChIKey | MSEYESOBRMJOIA-WNCSPTOFSA-N |
| XLogP | 8.78 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.08 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|