About 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol
3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol (PubChem CID 164734485) has the molecular formula C16H40O5Si3
and a molecular weight of 396.75 g/mol. Its IUPAC name is 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol |
| PubChem CID | 164734485 |
| Molecular Formula | C16H40O5Si3 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol |
| SMILES | CC(C)(CCOCC(O)CO)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H40O5Si3/c1-16(2,10-11-19-13-15(18)12-17)14-24(9,20-22(3,4)5)21-23(6,7)8/h15,17-18H,10-14H2,1-9H3 |
| InChIKey | LNEGDRXTTPAZGW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol?
The IUPAC name of 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol (CID 164734485) is 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol.
What is the SMILES notation for 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol?
The canonical SMILES for 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol is CC(C)(CCOCC(O)CO)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol?
The InChIKey is LNEGDRXTTPAZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H40O5Si3/c1-16(2,10-11-19-13-15(18)12-17)14-24(9,20-22(3,4)5)21-23(6,7)8/h15,17-18H,10-14H2,1-9H3.
What are the key properties of 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol?
3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol has a molecular weight of 396.75 g/mol, XLogP of 3.55, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-dimethyl-4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,2-diol is sourced from PubChem (CID 164734485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).