About 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one
3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one (PubChem CID 164734519) has the molecular formula C10H11BrF2N2O
and a molecular weight of 293.11 g/mol. Its IUPAC name is 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one |
| PubChem CID | 164734519 |
| Molecular Formula | C10H11BrF2N2O |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C2CNCCC2(F)F)cc1Br |
| InChI | InChI=1S/C10H11BrF2N2O/c11-8-3-6(4-15-9(8)16)7-5-14-2-1-10(7,12)13/h3-4,7,14H,1-2,5H2,(H,15,16) |
| InChIKey | MULRKIOQCIBZED-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one?
The IUPAC name of 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one (CID 164734519) is 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one.
What is the SMILES notation for 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one?
The canonical SMILES for 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one is O=c1[nH]cc(C2CNCCC2(F)F)cc1Br.
What is the InChIKey of 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one?
The InChIKey is MULRKIOQCIBZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrF2N2O/c11-8-3-6(4-15-9(8)16)7-5-14-2-1-10(7,12)13/h3-4,7,14H,1-2,5H2,(H,15,16).
What are the key properties of 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one?
3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one has a molecular weight of 293.11 g/mol, XLogP of 1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one is sourced from PubChem (CID 164734519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).