About tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate
tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate (PubChem CID 164734568) has the molecular formula C18H26F2N2O3
and a molecular weight of 356.41 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate |
| PubChem CID | 164734568 |
| Molecular Formula | C18H26F2N2O3 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate |
| SMILES | CC(C)n1cc(C2CN(C(=O)OC(C)(C)C)CCC2(F)F)ccc1=O |
| InChI | InChI=1S/C18H26F2N2O3/c1-12(2)22-10-13(6-7-15(22)23)14-11-21(9-8-18(14,19)20)16(24)25-17(3,4)5/h6-7,10,12,14H,8-9,11H2,1-5H3 |
| InChIKey | IDEILPIEYVWDLI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate (CID 164734568) is tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate is CC(C)n1cc(C2CN(C(=O)OC(C)(C)C)CCC2(F)F)ccc1=O.
What is the InChIKey of tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate?
The InChIKey is IDEILPIEYVWDLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F2N2O3/c1-12(2)22-10-13(6-7-15(22)23)14-11-21(9-8-18(14,19)20)16(24)25-17(3,4)5/h6-7,10,12,14H,8-9,11H2,1-5H3.
What are the key properties of tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate?
tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate has a molecular weight of 356.41 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4,4-difluoro-3-(6-oxo-1-propan-2-yl-3-pyridinyl)piperidine-1-carboxylate is sourced from PubChem (CID 164734568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).