About 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one
5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one (PubChem CID 164734624) has the molecular formula C12H16F2N2O3S
and a molecular weight of 306.33 g/mol. Its IUPAC name is 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one |
| PubChem CID | 164734624 |
| Molecular Formula | C12H16F2N2O3S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one |
| SMILES | CS(=O)(=O)Cc1cc(C2CNCCC2(F)F)c[nH]c1=O |
| InChI | InChI=1S/C12H16F2N2O3S/c1-20(18,19)7-9-4-8(5-16-11(9)17)10-6-15-3-2-12(10,13)14/h4-5,10,15H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | FCGQUQCVTANSTP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one?
The IUPAC name of 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one (CID 164734624) is 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one.
What is the SMILES notation for 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one?
The canonical SMILES for 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one is CS(=O)(=O)Cc1cc(C2CNCCC2(F)F)c[nH]c1=O.
What is the InChIKey of 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one?
The InChIKey is FCGQUQCVTANSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2O3S/c1-20(18,19)7-9-4-8(5-16-11(9)17)10-6-15-3-2-12(10,13)14/h4-5,10,15H,2-3,6-7H2,1H3,(H,16,17).
What are the key properties of 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one?
5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one has a molecular weight of 306.33 g/mol, XLogP of 0.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-difluoropiperidin-3-yl)-3-(methylsulfonylmethyl)-1H-pyridin-2-one is sourced from PubChem (CID 164734624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).