C19H14ClF3N2O4S2 — CID 164735344
[(7S)-7-(8-chloronaphthalen-1-yl)-2-methylsulfanyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl] trifluoromethanesulfonate (PubChem CID 164735344) has the molecular formula C19H14ClF3N2O4S2 and a molecular weight of 490.91 g/mol. Its IUPAC name is [(7S)-7-(8-chloronaphthalen-1-yl)-2-methylsulfanyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl] trifluoromethanesulfonate.
| Compound Name | [(7S)-7-(8-chloronaphthalen-1-yl)-2-methylsulfanyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164735344 |
| Molecular Formula | C19H14ClF3N2O4S2 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | [(7S)-7-(8-chloronaphthalen-1-yl)-2-methylsulfanyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl] trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CO[C@H](c1cccc3cccc(Cl)c13)C2 |
| InChI | InChI=1S/C19H14ClF3N2O4S2/c1-30-18-24-14-8-15(11-6-2-4-10-5-3-7-13(20)16(10)11)28-9-12(14)17(25-18)29-31(26,27)19(21,22)23/h2-7,15H,8-9H2,1H3/t15-/m0/s1 |
| InChIKey | JLRIPNQZEVEKPE-HNNXBMFYSA-N |
| XLogP | 5.05 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|