C19H38N2O3 — CID 164735629
5-[4-[2-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxyethyl]piperazin-1-yl]pentan-1-ol (PubChem CID 164735629) has the molecular formula C19H38N2O3 and a molecular weight of 342.52 g/mol. Its IUPAC name is 5-[4-[2-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxyethyl]piperazin-1-yl]pentan-1-ol.
| Compound Name | 5-[4-[2-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxyethyl]piperazin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 164735629 |
| Molecular Formula | C19H38N2O3 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 5-[4-[2-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxyethyl]piperazin-1-yl]pentan-1-ol |
| SMILES | CC(C)(C)OC1CC(OCCN2CCN(CCCCCO)CC2)C1 |
| InChI | InChI=1S/C19H38N2O3/c1-19(2,3)24-18-15-17(16-18)23-14-12-21-10-8-20(9-11-21)7-5-4-6-13-22/h17-18,22H,4-16H2,1-3H3 |
| InChIKey | IQGOHCGPAIUUJW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|