C15H12FNO3 — CID 164736922
ethyl 2-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)acetate (PubChem CID 164736922) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is ethyl 2-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)acetate.
| Compound Name | ethyl 2-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)acetate |
|---|---|
| PubChem CID | 164736922 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | ethyl 2-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)acetate |
| SMILES | CCOC(=O)Cc1noc2ccc3cc(F)ccc3c12 |
| InChI | InChI=1S/C15H12FNO3/c1-2-19-14(18)8-12-15-11-5-4-10(16)7-9(11)3-6-13(15)20-17-12/h3-7H,2,8H2,1H3 |
| InChIKey | XNRJCLFUQQFTSK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |