C56H55B2F2N3O4 — CID 164737677
9-(2,6-dimethylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine (PubChem CID 164737677) has the molecular formula C56H55B2F2N3O4 and a molecular weight of 893.69 g/mol. Its IUPAC name is 9-(2,6-dimethylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine.
| Compound Name | 9-(2,6-dimethylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 164737677 |
| Molecular Formula | C56H55B2F2N3O4 |
| Molecular Weight | 893.69 g/mol |
| Exact Mass | 893.43 |
| IUPAC Name | 9-(2,6-dimethylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
| SMILES | Cc1cccc(C)c1-n1c2ccc(N(c3ccc(F)cc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2c2cc(N(c3ccc(F)cc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)ccc21 |
| InChI | InChI=1S/C56H55B2F2N3O4/c1-36-12-11-13-37(2)52(36)63-50-32-30-46(61(44-26-18-40(59)19-27-44)42-22-14-38(15-23-42)57-64-53(3,4)54(5,6)65-57)34-48(50)49-35-47(31-33-51(49)63)62(45-28-20-41(60)21-29-45)43-24-16-39(17-25-43)58-66-55(7,8)56(9,10)67-58/h11-35H,1-10H3 |
| InChIKey | QZQTXJUFVODPMN-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.69 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|