C63H59B2F2N3O4 — CID 164737686
9-(9,9-dimethylfluoren-2-yl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine (PubChem CID 164737686) has the molecular formula C63H59B2F2N3O4 and a molecular weight of 981.80 g/mol. Its IUPAC name is 9-(9,9-dimethylfluoren-2-yl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine.
| Compound Name | 9-(9,9-dimethylfluoren-2-yl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 164737686 |
| Molecular Formula | C63H59B2F2N3O4 |
| Molecular Weight | 981.80 g/mol |
| Exact Mass | 981.47 |
| IUPAC Name | 9-(9,9-dimethylfluoren-2-yl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-n3c4ccc(N(c5ccc(F)cc5)c5ccc(B6OC(C)(C)C(C)(C)O6)cc5)cc4c4cc(N(c5ccc(F)cc5)c5ccc(B6OC(C)(C)C(C)(C)O6)cc5)ccc43)cc21 |
| InChI | InChI=1S/C63H59B2F2N3O4/c1-59(2)55-14-12-11-13-51(55)52-34-31-50(39-56(52)59)70-57-35-32-48(68(46-27-19-42(66)20-28-46)44-23-15-40(16-24-44)64-71-60(3,4)61(5,6)72-64)37-53(57)54-38-49(33-36-58(54)70)69(47-29-21-43(67)22-30-47)45-25-17-41(18-26-45)65-73-62(7,8)63(9,10)74-65/h11-39H,1-10H3 |
| InChIKey | XJESZRCZCCWDTN-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.80 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|