C62H64B2FN3O4 — CID 164737690
9-(4-fluorophenyl)-3-N,6-N-bis(5,6,7,8-tetrahydronaphthalen-2-yl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine (PubChem CID 164737690) has the molecular formula C62H64B2FN3O4 and a molecular weight of 955.83 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-3-N,6-N-bis(5,6,7,8-tetrahydronaphthalen-2-yl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine.
| Compound Name | 9-(4-fluorophenyl)-3-N,6-N-bis(5,6,7,8-tetrahydronaphthalen-2-yl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 164737690 |
| Molecular Formula | C62H64B2FN3O4 |
| Molecular Weight | 955.83 g/mol |
| Exact Mass | 955.51 |
| IUPAC Name | 9-(4-fluorophenyl)-3-N,6-N-bis(5,6,7,8-tetrahydronaphthalen-2-yl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
| SMILES | CC1(C)OB(c2ccc(N(c3ccc4c(c3)CCCC4)c3ccc4c(c3)c3cc(N(c5ccc(B6OC(C)(C)C(C)(C)O6)cc5)c5ccc6c(c5)CCCC6)ccc3n4-c3ccc(F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C62H64B2FN3O4/c1-59(2)60(3,4)70-63(69-59)45-19-27-48(28-20-45)66(51-25-17-41-13-9-11-15-43(41)37-51)53-33-35-57-55(39-53)56-40-54(34-36-58(56)68(57)50-31-23-47(65)24-32-50)67(52-26-18-42-14-10-12-16-44(42)38-52)49-29-21-46(22-30-49)64-71-61(5,6)62(7,8)72-64/h17-40H,9-16H2,1-8H3 |
| InChIKey | YGSIXEKFGMHXNL-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.83 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|