C58H59B2F2N3O4 — CID 164737731
9-(4-tert-butylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine (PubChem CID 164737731) has the molecular formula C58H59B2F2N3O4 and a molecular weight of 921.75 g/mol. Its IUPAC name is 9-(4-tert-butylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine.
| Compound Name | 9-(4-tert-butylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 164737731 |
| Molecular Formula | C58H59B2F2N3O4 |
| Molecular Weight | 921.75 g/mol |
| Exact Mass | 921.47 |
| IUPAC Name | 9-(4-tert-butylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
| SMILES | CC(C)(C)c1ccc(-n2c3ccc(N(c4ccc(F)cc4)c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)cc3c3cc(N(c4ccc(F)cc4)c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)ccc32)cc1 |
| InChI | InChI=1S/C58H59B2F2N3O4/c1-54(2,3)38-12-22-47(23-13-38)65-52-34-32-48(63(45-28-18-41(61)19-29-45)43-24-14-39(15-25-43)59-66-55(4,5)56(6,7)67-59)36-50(52)51-37-49(33-35-53(51)65)64(46-30-20-42(62)21-31-46)44-26-16-40(17-27-44)60-68-57(8,9)58(10,11)69-60/h12-37H,1-11H3 |
| InChIKey | HXIACWIZZQJRIV-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.75 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|