C59H56B2FN3O4 — CID 164737747
6-N-(4-fluorophenyl)-3-N-(4-methylphenyl)-9-naphthalen-1-yl-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine (PubChem CID 164737747) has the molecular formula C59H56B2FN3O4 and a molecular weight of 911.74 g/mol. Its IUPAC name is 6-N-(4-fluorophenyl)-3-N-(4-methylphenyl)-9-naphthalen-1-yl-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine.
| Compound Name | 6-N-(4-fluorophenyl)-3-N-(4-methylphenyl)-9-naphthalen-1-yl-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 164737747 |
| Molecular Formula | C59H56B2FN3O4 |
| Molecular Weight | 911.74 g/mol |
| Exact Mass | 911.44 |
| IUPAC Name | 6-N-(4-fluorophenyl)-3-N-(4-methylphenyl)-9-naphthalen-1-yl-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
| SMILES | Cc1ccc(N(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c2ccc3c(c2)c2cc(N(c4ccc(F)cc4)c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)ccc2n3-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C59H56B2FN3O4/c1-39-17-25-44(26-18-39)63(45-27-19-41(20-28-45)60-66-56(2,3)57(4,5)67-60)48-33-35-54-51(37-48)52-38-49(34-36-55(52)65(54)53-16-12-14-40-13-10-11-15-50(40)53)64(47-31-23-43(62)24-32-47)46-29-21-42(22-30-46)61-68-58(6,7)59(8,9)69-61/h10-38H,1-9H3 |
| InChIKey | HPBCXSHXASPICV-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.74 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|