C24H22FN5O2 — CID 164737810
(R)-[4-fluoro-3-[7-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)quinazolin-4-yl]phenyl]-(3-methylpyrazin-2-yl)methanol (PubChem CID 164737810) has the molecular formula C24H22FN5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is (R)-[4-fluoro-3-[7-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)quinazolin-4-yl]phenyl]-(3-methylpyrazin-2-yl)methanol.
| Compound Name | (R)-[4-fluoro-3-[7-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)quinazolin-4-yl]phenyl]-(3-methylpyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 164737810 |
| Molecular Formula | C24H22FN5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (R)-[4-fluoro-3-[7-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)quinazolin-4-yl]phenyl]-(3-methylpyrazin-2-yl)methanol |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(c2ccc3c(-c4cc([C@@H](O)c5nccnc5C)ccc4F)ncnc3c2)C1([2H])[2H] |
| InChI | InChI=1S/C24H22FN5O2/c1-15-22(27-7-6-26-15)24(31)16-2-5-20(25)19(12-16)23-18-4-3-17(13-21(18)28-14-29-23)30-8-10-32-11-9-30/h2-7,12-14,24,31H,8-11H2,1H3/t24-/m1/s1/i8D2,9D2,10D2,11D2 |
| InChIKey | PCPCDRDQIBENHU-OEVIDNBTSA-N |
| XLogP | 3.45 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |