C12H11N3O3S — CID 164738705
N-[7-(2,5-dihydrofuran-3-yl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-2-yl]formamide (PubChem CID 164738705) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-[7-(2,5-dihydrofuran-3-yl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-2-yl]formamide.
| Compound Name | N-[7-(2,5-dihydrofuran-3-yl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-2-yl]formamide |
|---|---|
| PubChem CID | 164738705 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-[7-(2,5-dihydrofuran-3-yl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-2-yl]formamide |
| SMILES | COc1ncc(C2=CCOC2)c2sc(NC=O)nc12 |
| InChI | InChI=1S/C12H11N3O3S/c1-17-11-9-10(19-12(15-9)14-6-16)8(4-13-11)7-2-3-18-5-7/h2,4,6H,3,5H2,1H3,(H,14,15,16) |
| InChIKey | HRFYQOVTNJIXEB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|