C22H32F3N7OSi — CID 164739893
3,3,3-trifluoro-N-[[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methyl]propan-1-amine (PubChem CID 164739893) has the molecular formula C22H32F3N7OSi and a molecular weight of 495.63 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 164739893 |
| Molecular Formula | C22H32F3N7OSi |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 3,3,3-trifluoro-N-[[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methyl]propan-1-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(N3CCc4[nH]nc(CNCCC(F)(F)F)c4C3)ncnc21 |
| InChI | InChI=1S/C22H32F3N7OSi/c1-34(2,3)11-10-33-15-32-8-4-16-20(27-14-28-21(16)32)31-9-5-18-17(13-31)19(30-29-18)12-26-7-6-22(23,24)25/h4,8,14,26H,5-7,9-13,15H2,1-3H3,(H,29,30) |
| InChIKey | TUJKJNHFNRYNMY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|