C21H30N6O3Si — CID 164739901
ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxylate (PubChem CID 164739901) has the molecular formula C21H30N6O3Si and a molecular weight of 442.60 g/mol. Its IUPAC name is ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164739901 |
| Molecular Formula | C21H30N6O3Si |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2c1CN(c1ncnc3c1ccn3COCC[Si](C)(C)C)CC2 |
| InChI | InChI=1S/C21H30N6O3Si/c1-5-30-21(28)18-16-12-26(9-7-17(16)24-25-18)19-15-6-8-27(20(15)23-13-22-19)14-29-10-11-31(2,3)4/h6,8,13H,5,7,9-12,14H2,1-4H3,(H,24,25) |
| InChIKey | QGEVBSJKNNRGRL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|