C19H28N6O2Si — CID 164739912
[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol (PubChem CID 164739912) has the molecular formula C19H28N6O2Si and a molecular weight of 400.56 g/mol. Its IUPAC name is [5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol.
| Compound Name | [5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 164739912 |
| Molecular Formula | C19H28N6O2Si |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(N3CCc4[nH]nc(CO)c4C3)ncnc21 |
| InChI | InChI=1S/C19H28N6O2Si/c1-28(2,3)9-8-27-13-25-6-4-14-18(20-12-21-19(14)25)24-7-5-16-15(10-24)17(11-26)23-22-16/h4,6,12,26H,5,7-11,13H2,1-3H3,(H,22,23) |
| InChIKey | VIXMZKHNIMKAGG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|