C25H18F13NO4 — CID 164740980
2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoic acid (PubChem CID 164740980) has the molecular formula C25H18F13NO4 and a molecular weight of 643.40 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoic acid |
|---|---|
| PubChem CID | 164740980 |
| Molecular Formula | C25H18F13NO4 |
| Molecular Weight | 643.40 g/mol |
| Exact Mass | 643.10 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoic acid |
| SMILES | O=C(NC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H18F13NO4/c26-20(27,21(28,29)22(30,31)23(32,33)24(34,35)25(36,37)38)10-9-17(18(40)41)39-19(42)43-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,39,42)(H,40,41) |
| InChIKey | RXNYUVZEWYBZKA-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.40 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|